Learn More
Ethyl oleate, 98%, mixture of homologeous fatty acid esters, ACROS Organics™
Brand: Acros Organics 410290025
Additional Details : CAS Number : 111-62-6 Weight : 2.55000kg
| Packaging | Plastic bottle |
|---|---|
| Quantity | 2.5kg |
Chemical Identifiers
| 111-62-6 | |
| 310.51 | |
| ethyl oleate, ethyl cis-9-octadecenoate, oleic acid, ethyl ester, oleic acid ethyl ester, 9-octadecenoic acid z-, ethyl ester, ethyl oleate nf, ethyl z-octadec-9-enoate, ethyl oleate natural, fema no. 2450 | |
| CHEBI:84940 | |
| CCCCCCCCC=CCCCCCCCC(=O)OCC |
| C20H38O2 | |
| LVGKNOAMLMIIKO-QXMHVHEDSA-N | |
| 5363269 | |
| ethyl (Z)-octadec-9-enoate |
Specifications
| 0.5mg KOH/g max. | |
| 0.8600g/mL | |
| Authentic | |
| 1.4490 to 1.4530 | |
| 0.86 | |
| 190.0°C to 210.0°C (7.0mmHg) | |
| 2.5kg | |
| 60% min. (oleic acid) (GC) | |
| CH3(CH2)7CHCH(CH2)7COOC2H5 | |
| Solubility in water: insoluble. Other solubilities: soluble in alcohol | |
| CCCCCCCCC=CCCCCCCCC(=O)OCC | |
| 310.51 | |
| CHEBI:84940 | |
| Oily Liquid |
| Ethyl oleate | |
| 160°C | |
| Plastic bottle | |
| 177 to 188mg KOH/g | |
| 1% Max. (K.F.) | |
| Undesignated | |
| 111-62-6 | |
| C20H38O2 | |
| ethyl oleate, ethyl cis-9-octadecenoate, oleic acid, ethyl ester, oleic acid ethyl ester, 9-octadecenoic acid z-, ethyl ester, ethyl oleate nf, ethyl z-octadec-9-enoate, ethyl oleate natural, fema no. 2450 | |
| LVGKNOAMLMIIKO-QXMHVHEDSA-N | |
| ethyl (Z)-octadec-9-enoate | |
| 5363269 | |
| 310.51 | |
| 98% |