Tetrakarboxylsyror och derivat
Filtrerade sökresultat
Etylendiamintetraättiksyra, Honeywell Fluka™
CAS: 60-00-4 Molekylformel: C10H16N2O8 Molekylvikt (g/mol): 292.24 MDL-nummer: MFCD00003541 InChI-nyckel: KCXVZYZYPLLWCC-UHFFFAOYSA-N Synonym: edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol PubChem CID: 6049 ChEBI: CHEBI:42191 LEDER: OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
| Molekylformel | C10H16N2O8 |
|---|---|
| PubChem CID | 6049 |
| MDL-nummer | MFCD00003541 |
| CAS | 60-00-4 |
| InChI-nyckel | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| LEDER | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| ChEBI | CHEBI:42191 |
| Molekylvikt (g/mol) | 292.24 |
| Synonym | edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol |
1,2-diaminocyklohexantetraättiksyramonohydrat, Honeywell Fluka™
CAS: 145819-99-4 Molekylformel: C14H24N2O9 Molekylvikt (g/mol): 364.351 MDL-nummer: MFCD00150952 InChI-nyckel: VASZYFIKPKYGNC-UHFFFAOYSA-N Synonym: cdta hydrate,glycine, n,n'-1,2-cyclohexanediylbis n-carboxymethyl-, monohydrate,trans-1,2-cyclohexanediamine-n,n,n',n'-tetraacetic acid monohydrate,acmc-20n4nc,1,2-diaminocyclohexanetetraacetic acid monohydrate,trans-1,2-cyclohexanediamine-n,n,n',n-tetraacetic acid,2,2',2,2'-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,2,2',2,2'-cyclohexane-1,2-diyldinitrilo tetraacetic acid-water 1/1,2-2-bis carboxymethyl amino cyclohexyl-carboxymethyl amino acetic acid hydrate,1,2-diaminocyclohexanetetraacetic acid monohydrate for complexometry, inverted exclamation marky PubChem CID: 18674933 IUPAC-namn: 2-[[2-[bis(karboximetyl)amino]cyklohexyl]-(karboximetyl)amino]ättiksyra;hydrat LEDER: C1CCC(C(C1)N(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O.O
| Molekylformel | C14H24N2O9 |
|---|---|
| PubChem CID | 18674933 |
| MDL-nummer | MFCD00150952 |
| IUPAC-namn | 2-[[2-[bis(karboximetyl)amino]cyklohexyl]-(karboximetyl)amino]ättiksyra;hydrat |
| CAS | 145819-99-4 |
| InChI-nyckel | VASZYFIKPKYGNC-UHFFFAOYSA-N |
| LEDER | C1CCC(C(C1)N(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O.O |
| Molekylvikt (g/mol) | 364.351 |
| Synonym | cdta hydrate,glycine, n,n'-1,2-cyclohexanediylbis n-carboxymethyl-, monohydrate,trans-1,2-cyclohexanediamine-n,n,n',n'-tetraacetic acid monohydrate,acmc-20n4nc,1,2-diaminocyclohexanetetraacetic acid monohydrate,trans-1,2-cyclohexanediamine-n,n,n',n-tetraacetic acid,2,2',2,2'-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,2,2',2,2'-cyclohexane-1,2-diyldinitrilo tetraacetic acid-water 1/1,2-2-bis carboxymethyl amino cyclohexyl-carboxymethyl amino acetic acid hydrate,1,2-diaminocyclohexanetetraacetic acid monohydrate for complexometry, inverted exclamation marky |
Etylendiamintetraättiksyra, 99 %, Thermo Scientific Chemicals
CAS: 60-00-4 Molekylformel: C10H16N2O8 Molekylvikt (g/mol): 292.24 MDL-nummer: MFCD00003541 InChI-nyckel: KCXVZYZYPLLWCC-UHFFFAOYSA-N Synonym: edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol PubChem CID: 6049 ChEBI: CHEBI:42191 IUPAC-namn: 2-[2-[bis(karboximetyl)amino]etyl-(karboximetyl)amino]ättiksyra LEDER: OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
| Molekylformel | C10H16N2O8 |
|---|---|
| PubChem CID | 6049 |
| MDL-nummer | MFCD00003541 |
| IUPAC-namn | 2-[2-[bis(karboximetyl)amino]etyl-(karboximetyl)amino]ättiksyra |
| CAS | 60-00-4 |
| InChI-nyckel | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| LEDER | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| ChEBI | CHEBI:42191 |
| Molekylvikt (g/mol) | 292.24 |
| Synonym | edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol |
Ethylenediaminetetraacetic acid, ACS, 99.4+%
CAS: 60-00-4 Molekylformel: C10H16N2O8 Molekylvikt (g/mol): 292.24 MDL-nummer: MFCD00003541 InChI-nyckel: KCXVZYZYPLLWCC-UHFFFAOYSA-N Synonym: edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol PubChem CID: 6049 ChEBI: CHEBI:42191 IUPAC-namn: 2-[2-[bis(karboximetyl)amino]etyl-(karboximetyl)amino]ättiksyra LEDER: OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
| Molekylformel | C10H16N2O8 |
|---|---|
| PubChem CID | 6049 |
| MDL-nummer | MFCD00003541 |
| IUPAC-namn | 2-[2-[bis(karboximetyl)amino]etyl-(karboximetyl)amino]ättiksyra |
| CAS | 60-00-4 |
| InChI-nyckel | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| LEDER | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| ChEBI | CHEBI:42191 |
| Molekylvikt (g/mol) | 292.24 |
| Synonym | edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol |
Thermo Scientific Chemicals Etylendiamintetraättiksyra, 99%, ren
CAS: 60-00-4 Molekylformel: C10H16N2O8 Molekylvikt (g/mol): 292.24 MDL-nummer: MFCD00003541 InChI-nyckel: KCXVZYZYPLLWCC-UHFFFAOYSA-N Synonym: edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol PubChem CID: 6049 ChEBI: CHEBI:42191 IUPAC-namn: 2-[2-[bis(karboximetyl)amino]etyl-(karboximetyl)amino]ättiksyra LEDER: OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
| Molekylformel | C10H16N2O8 |
|---|---|
| PubChem CID | 6049 |
| MDL-nummer | MFCD00003541 |
| IUPAC-namn | 2-[2-[bis(karboximetyl)amino]etyl-(karboximetyl)amino]ättiksyra |
| CAS | 60-00-4 |
| InChI-nyckel | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| LEDER | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| ChEBI | CHEBI:42191 |
| Molekylvikt (g/mol) | 292.24 |
| Synonym | edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol |
trans-1,2-diaminocyklohexan-N,N,N',N'-tetraättiksyramonohydrat, ACS, 97,5%-100,5%, Thermo Scientific Chemicals
CAS: 125572-95-4 Molekylformel: C14H20N2O8 Molekylvikt (g/mol): 344.32 MDL-nummer: MFCD00149243,MFCD00066429,MFCD00003845 InChI-nyckel: FCKYPQBAHLOOJQ-NXEZZACHSA-L Synonym: 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,dcyta,trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate,1,2-cyclohexanedinitrilotetraacetic acid,2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,trans-1,2-cyclohexanediaminetetraacetic acid monohydrate,cdta monohydrate,ctda monohydrate,chel-cd,chel r-cd PubChem CID: 2723844 IUPAC-namn: 2-[[(lR,2R)-2-[bis(karboximetyl)amino]cyklohexyl]-(karboximetyl)amino]ättiksyra;hydrat LEDER: [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O
| Molekylformel | C14H20N2O8 |
|---|---|
| PubChem CID | 2723844 |
| MDL-nummer | MFCD00149243,MFCD00066429,MFCD00003845 |
| IUPAC-namn | 2-[[(lR,2R)-2-[bis(karboximetyl)amino]cyklohexyl]-(karboximetyl)amino]ättiksyra;hydrat |
| CAS | 125572-95-4 |
| InChI-nyckel | FCKYPQBAHLOOJQ-NXEZZACHSA-L |
| LEDER | [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O |
| Molekylvikt (g/mol) | 344.32 |
| Synonym | 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,dcyta,trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate,1,2-cyclohexanedinitrilotetraacetic acid,2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,trans-1,2-cyclohexanediaminetetraacetic acid monohydrate,cdta monohydrate,ctda monohydrate,chel-cd,chel r-cd |
trans-1,2-diaminocyklohexan-N,N,N',N'-tetraättiksyramonohydrat, 98 %, Thermo Scientific Chemicals
CAS: 125572-95-4 Molekylformel: C14H20N2O8 Molekylvikt (g/mol): 344.32 MDL-nummer: MFCD00149243,MFCD00066429,MFCD00003845 InChI-nyckel: FCKYPQBAHLOOJQ-NXEZZACHSA-L Synonym: 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,dcyta,trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate,1,2-cyclohexanedinitrilotetraacetic acid,2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,trans-1,2-cyclohexanediaminetetraacetic acid monohydrate,cdta monohydrate,ctda monohydrate,chel-cd,chel r-cd PubChem CID: 2723844 IUPAC-namn: 2-[[(lR,2R)-2-[bis(karboximetyl)amino]cyklohexyl]-(karboximetyl)amino]ättiksyra;hydrat LEDER: [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O
| Molekylformel | C14H20N2O8 |
|---|---|
| PubChem CID | 2723844 |
| MDL-nummer | MFCD00149243,MFCD00066429,MFCD00003845 |
| IUPAC-namn | 2-[[(lR,2R)-2-[bis(karboximetyl)amino]cyklohexyl]-(karboximetyl)amino]ättiksyra;hydrat |
| CAS | 125572-95-4 |
| InChI-nyckel | FCKYPQBAHLOOJQ-NXEZZACHSA-L |
| LEDER | [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O |
| Molekylvikt (g/mol) | 344.32 |
| Synonym | 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,dcyta,trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate,1,2-cyclohexanedinitrilotetraacetic acid,2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,trans-1,2-cyclohexanediaminetetraacetic acid monohydrate,cdta monohydrate,ctda monohydrate,chel-cd,chel r-cd |
Thermo Scientific Chemicals Etylendiamintetraättiksyra, 99,5 %, ACS-reagens
CAS: 60-00-4 Molekylformel: C10H16N2O8 Molekylvikt (g/mol): 292.24 MDL-nummer: MFCD00003541 InChI-nyckel: KCXVZYZYPLLWCC-UHFFFAOYSA-N Synonym: edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol PubChem CID: 6049 ChEBI: CHEBI:42191 IUPAC-namn: 2-[2-[bis(karboximetyl)amino]etyl-(karboximetyl)amino]ättiksyra LEDER: OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
| Molekylformel | C10H16N2O8 |
|---|---|
| PubChem CID | 6049 |
| MDL-nummer | MFCD00003541 |
| IUPAC-namn | 2-[2-[bis(karboximetyl)amino]etyl-(karboximetyl)amino]ättiksyra |
| CAS | 60-00-4 |
| InChI-nyckel | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| LEDER | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| ChEBI | CHEBI:42191 |
| Molekylvikt (g/mol) | 292.24 |
| Synonym | edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol |
trans-1,2-Diaminocyclohexane-N,N,N',N'-tetraacetic Acid Monohydrate, 98%
CAS: 125572-95-4 Molekylformel: C14H20N2O8 Molekylvikt (g/mol): 344.32 MDL-nummer: MFCD00149243,MFCD00066429,MFCD00003845 InChI-nyckel: FCKYPQBAHLOOJQ-NXEZZACHSA-L Synonym: 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,dcyta,trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate,1,2-cyclohexanedinitrilotetraacetic acid,2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,trans-1,2-cyclohexanediaminetetraacetic acid monohydrate,cdta monohydrate,ctda monohydrate,chel-cd,chel r-cd PubChem CID: 2723844 LEDER: [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O
| Molekylformel | C14H20N2O8 |
|---|---|
| PubChem CID | 2723844 |
| MDL-nummer | MFCD00149243,MFCD00066429,MFCD00003845 |
| CAS | 125572-95-4 |
| InChI-nyckel | FCKYPQBAHLOOJQ-NXEZZACHSA-L |
| LEDER | [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O |
| Molekylvikt (g/mol) | 344.32 |
| Synonym | 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,dcyta,trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate,1,2-cyclohexanedinitrilotetraacetic acid,2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,trans-1,2-cyclohexanediaminetetraacetic acid monohydrate,cdta monohydrate,ctda monohydrate,chel-cd,chel r-cd |
SGC3027, MedChemExpress
MedChemExpress SGC3027 is a histone methyltransferase inhibitor. SGC3027 is the first potent, selective and cell active chemical probe for PRMT7.
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
ARQ 531, MedChemExpress
MedChemExpress ARQ 531 (MK-1026) is a reversible non-covalent and orally active inhibitor of Bruton’s Tyrosine Kinase (BTK), with IC50s of 0.85 nM and 0.39 nM for WT-BTK and C481S-BTK, respectively.
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
| Molekylformel | C25H23ClN4O4 |
|---|---|
| Rekommenderad förvaring | Powder -20°C 3 years, 4°C 2 years∣In solvent -80°C 6 months, -20°C 1 month |
| Formel vikt | 478.93 |
| Hållbarhet | Powder -20°C 3 years, 4°C 2 years∣In solvent -80°C 6 months, -20°C 1 month |
| Hälsofara 1 | H302∣H315∣H319∣H335 |
| Löslighetsinformation | DMSO : ≥ 50 mg/mL (104.40 mM) |
| Anteckningar om renhetsgrad | Research |
| Fysisk form | Powder |
| Kvalitet | Research |
| Färg | Off-White |
| CAS | 2095393-15-8 |
| LEDER | O=C(C1=C(C=C(OC2=CC=CC=C2)C=C1)Cl)C3=CNC4=NC=NC(N[C@@H]5CC[C@@H](CO)OC5)=C34 |
| Molekylvikt (g/mol) | 478.93 |
| Synonym | MK-1026 |
| Kemiskt namn eller material | ARQ 531 |
| Procent renhet | 98.52% |
| För användning med (applikation) | Cancer-Kinase/protease |
BAPTA-AM, MedChemExpress
MedChemExpress BAPTA-AM is a well-known membrane permeable Ca2+ chelator. BAPTA-AM inhibits hERG channels, hKv1.3 and hKv1.5 channels in HEK 293 cells with IC50s of 1.3 μM, 1.45 μM and 1.23 μM, respectively.
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
| Molekylformel | C34H40N2O18 |
|---|---|
| Rekommenderad förvaring | Powder -20°C 3 years, 4°C 2 years∣In solvent -80°C 6 months, -20°C 1 month |
| Formel vikt | 764.68 |
| Hållbarhet | Powder -20°C 3 years, 4°C 2 years∣In solvent -80°C 6 months, -20°C 1 month |
| Löslighetsinformation | DMSO : 50 mg/mL (65.39 mM; Need ultrasonic) ∣H2O : < 0.1 mg/mL (ultrasonic) (insoluble) |
| Anteckningar om renhetsgrad | Research |
| Fysisk form | Solid |
| Kvalitet | Research |
| Färg | Off-White |
| CAS | 126150-97-8 |
| LEDER | O=C(OCOC(C)=O)CN(C(C=CC=C1)=C1OCCOC(C=CC=C2)=C2N(CC(OCOC(C)=O)=O)CC(OCOC(C)=O)=O)CC(OCOC(C)=O)=O |
| Molekylvikt (g/mol) | 764.68 |
| Kemiskt namn eller material | BAPTA-AM |
| Procent renhet | 98.38% |
EDO-S101, MedChemExpress
MedChemExpress EDO-S101 (Tinostamustine) is a pan HDAC inhibitor; inhibits HDAC6, HDAC1, HDAC2 and HDAC3 with IC50 values of 6 nM, 9 nM, 9 nM and 25 nM, respectively.
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
| Molekylformel | C19H28Cl2N4O2 |
|---|---|
| Rekommenderad förvaring | Powder -20°C 3 years, 4°C 2 years∣In solvent -80°C 6 months, -20°C 1 month |
| Formel vikt | 415.36 |
| Hållbarhet | Powder -20°C 3 years, 4°C 2 years∣In solvent -80°C 6 months, -20°C 1 month |
| Löslighetsinformation | DMSO : 100 mg/mL (240.76 mM; Need ultrasonic) |
| Anteckningar om renhetsgrad | Research |
| Fysisk form | Solid |
| Kvalitet | Research |
| Färg | Off-White |
| CAS | 1236199-60-2 |
| LEDER | O=C(NO)CCCCCCC1=NC2=CC(N(CCCl)CCCl)=CC=C2N1C |
| Molekylvikt (g/mol) | 415.36 |
| Synonym | Tinostamustine |
| Kemiskt namn eller material | EDO-S101 |
| Procent renhet | 98.0% |
| För användning med (applikation) | Cancer-programmed cell death |
(+)-JQ-1, MedChemExpress
MedChemExpress (+)-JQ-1 (JQ1) is a potent, specific, and reversible BET bromodomain inhibitor, with IC50s of 77 and 33 nM for the first and second bromodomain (BRD4(1/2)). (+)-JQ-1 also activates autophagy.
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
| Molekylformel | C23H25ClN4O2S |
|---|---|
| Rekommenderad förvaring | Powder -20°C 3 years, 4°C 2 years∣In solvent -80°C 6 months, -20°C 1 month |
| Formel vikt | 456.99 |
| Hållbarhet | Powder -20°C 3 years, 4°C 2 years∣In solvent -80°C 6 months, -20°C 1 month |
| Löslighetsinformation | DMSO : ≥ 45 mg/mL (98.47 mM) |
| Anteckningar om renhetsgrad | Research |
| Fysisk form | Solid |
| Kvalitet | Research |
| Färg | Light Yellow |
| CAS | 1268524-70-4 |
| LEDER | O=C(C[C@H]1C2=NN=C(N2C3=C(C(C4=CC=C(C=C4)Cl)=N1)C(C)=C(S3)C)C)OC(C)(C)C |
| Molekylvikt (g/mol) | 456.99 |
| Synonym | JQ1 |
| Kemiskt namn eller material | (+)-JQ-1 |
| Procent renhet | 98.65% |
| För användning med (applikation) | Cancer-programmed cell death |