Organiska standarder
- (1)
- (3)
- (3)
- (1)
- (3)
- (3)
- (3)
- (2)
- (1)
- (2)
- (3)
- (3)
- (3)
- (2)
- (2)
- (3)
- (3)
- (3)
- (1)
- (40)
- (3)
- (1)
- (1)
- (1)
- (1)
- (1)
Filtrerade sökresultat
N-Benzyl Metaxalone, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
| Molekylformel | C19 H21 N O3 |
|---|---|
| Rekommenderad förvaring | +4°C |
| Analyt- eller komponentnamn | N-Benzyl Metaxalone |
| InChI formel | InChI=1S/C19H21NO3/c1-14-8-15(2)10-17(9-14)22-13-18-12-20(19(21)23-18)11-16-6-4-3-5-7-16/h3-10,18H,11-13H2,1-2H3 |
| Formel vikt | 311.1521 |
| IUPAC-namn | 3-benzyl-5-[(3,5-dimethylphenoxy)methyl]oxazolidin-2-one |
| LEDER | CC1=CC(OCC(OC2=O)CN2CC3=CC=CC=C3)=CC(C)=C1 |
| Molekylvikt (g/mol) | 311.37494 |
| Synonym | 3-Benzyl-5-((3,5-dimethylphenoxy)methyl)oxazolidin-2-one |
| Frakt skick | Room Temperature |
| Kemiskt namn eller material | N-Benzyl Metaxalone |
| dimIndustryType | Pharmaceutical |
| Lösningstyp | Neat |
rac N-Desethyl N-Benzyl Milnacipran Chloride, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
| Molekylformel | C20 H25 N2 O . Cl |
|---|---|
| Analyt- eller komponentnamn | rac N-Desethyl N-Benzyl Milnacipran Chloride |
| InChI formel | InChI=1S/C20H24N2O.ClH/c1-2-22(15-16-9-5-3-6-10-16)19(23)20(13-18(20)14-21)17-11-7-4-8-12-17;/h3-12,18H,2,13-15,21H2,1H3;1H/t18-,20+;/m1./s1 |
| Formel vikt | 344.166 |
| IUPAC-namn | [(1S,2R)-2-[benzyl(ethyl)carbamoyl]-2-phenylcyclopropyl]methylazanium;chloride |
| LEDER | [Cl-].CCN(Cc1ccccc1)C(=O)[C@@]2(C[C@@H]2C[NH3+])c3ccccc3 |
| Molekylvikt (g/mol) | 344.878 |
| Synonym | (1R,2S)-rel-2-(Aminomethyl)-N-ethyl-1-phenyl-N-(phenylmethyl)-cyclopropanecarboxamide Chloride |
| Frakt skick | Room Temperature |
| Kemiskt namn eller material | rac N-Desethyl N-Benzyl Milnacipran Chloride |
| dimIndustryType | Pharmaceutical |
| Lösningstyp | Neat |
N-Benzyl-4-chloropentanamide, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
| Molekylformel | C3 H8 Br O3 P |
|---|---|
| Analyt- eller komponentnamn | N-Benzyl-4-chloropentanamide |
| InChI formel | InChI=1S/C3H8BrO3P/c4-2-1-3-8(5,6)7/h1-3H2,(H2,5,6,7) |
| Formel vikt | 201.939 |
| IUPAC-namn | 3-bromopropylphosphonic acid |
| LEDER | OP(=O)(O)CCCBr |
| Molekylvikt (g/mol) | 202.972 |
| Frakt skick | Room Temperature |
| Kemiskt namn eller material | N-Benzyl-4-chloropentanamide |
| dimIndustryType | Pharmaceutical |
| Lösningstyp | Neat |
(R)-2-Amino-N-benzyl-3-methoxypropionamide, TRC
CAS: 196601-69-1 Kemiskt namn eller material: (R)-2-Amino-N-benzyl-3-methoxypropionamide Formel vikt: 208.1212 InChI formel: InChI=1S/C11H16N2O2/c1-15-8-10(12)11(14)13-7-9-5-3-2-4-6-9/h2-6,10H,7-8,12H2,1H3,(H,13,14)/t10-/m1/s1 IUPAC-namn: (2R)-2-amino-N-benzyl-3-methoxypropanamide Molekylformel: C11 H16 N2 O2 Molekylvikt (g/mol): 208.26 Procent renhet: >95% Anteckningar om renhetsgrad: HPLC Rekommenderad förvaring: +4°C LEDER: COC[C@@H](N)C(=O)NCc1ccccc1 Synonym: Propanamide, 2-amino-3-methoxy-N-(phenylmethyl)-, (R)-,(2R)-2-Amino-3-methoxy-N-(phenylmethyl)propanamide,(2R)-2-Amino-3-methoxy-N-(phenylmethyl)propanamide,(2R)-2-Amino-N-benzyl-3-methoxypropanamide,(R)-2-Amino-N-benzyl-3-methoxypropionamide
| Rekommenderad förvaring | +4°C |
|---|---|
| Molekylformel | C11 H16 N2 O2 |
| InChI formel | InChI=1S/C11H16N2O2/c1-15-8-10(12)11(14)13-7-9-5-3-2-4-6-9/h2-6,10H,7-8,12H2,1H3,(H,13,14)/t10-/m1/s1 |
| IUPAC-namn | (2R)-2-amino-N-benzyl-3-methoxypropanamide |
| Formel vikt | 208.1212 |
| CAS | 196601-69-1 |
| LEDER | COC[C@@H](N)C(=O)NCc1ccccc1 |
| Molekylvikt (g/mol) | 208.26 |
| Synonym | Propanamide, 2-amino-3-methoxy-N-(phenylmethyl)-, (R)-,(2R)-2-Amino-3-methoxy-N-(phenylmethyl)propanamide,(2R)-2-Amino-3-methoxy-N-(phenylmethyl)propanamide,(2R)-2-Amino-N-benzyl-3-methoxypropanamide,(R)-2-Amino-N-benzyl-3-methoxypropionamide |
| Kemiskt namn eller material | (R)-2-Amino-N-benzyl-3-methoxypropionamide |
| Procent renhet | >95% |
| Anteckningar om renhetsgrad | HPLC |
3-(Benzo[d][1,3]dioxol-5-yl)-N-benzyl-N,2-dimethylpropan-1-amine, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
| Molekylformel | C19 H23 N O2 |
|---|---|
| Rekommenderad förvaring | +20°C |
| Analyt- eller komponentnamn | 3-(Benzo[d][1,3]dioxol-5-yl)-N-benzyl-N,2-dimethylpropan-1-amine |
| InChI formel | InChI=1S/C19H23NO2/c1-15(12-20(2)13-16-6-4-3-5-7-16)10-17-8-9-18-19(11-17)22-14-21-18/h3-9,11,15H,10,12-14H2,1-2H3 |
| Formel vikt | 297.173 |
| IUPAC-namn | 3-(1,3-benzodioxol-5-yl)-N-benzyl-N,2-dimethylpropan-1-amine |
| LEDER | CC(CN(C)Cc1ccccc1)Cc2ccc3OCOc3c2 |
| Molekylvikt (g/mol) | 297.391 |
| Frakt skick | Room Temperature |
| Kemiskt namn eller material | 3-(Benzo[d][1,3]dioxol-5-yl)-N-benzyl-N,2-dimethylpropan-1-amine |
| dimIndustryType | Pharmaceutical |
| Lösningstyp | Neat |
4-(Benzyl(methyl)amino)-N-methoxy-N-methylbenzamide, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
| Molekylformel | C17 H20 N2 O2 |
|---|---|
| Analyt- eller komponentnamn | 4-(Benzyl(methyl)amino)-N-methoxy-N-methylbenzamide |
| InChI formel | InChI=1S/C17H20N2O2/c1-18(13-14-7-5-4-6-8-14)16-11-9-15(10-12-16)17(20)19(2)21-3/h4-12H,13H2,1-3H3 |
| Formel vikt | 284.152 |
| IUPAC-namn | 4-[benzyl(methyl)amino]-N-methoxy-N-methylbenzamide |
| LEDER | CON(C)C(=O)c1ccc(cc1)N(C)Cc2ccccc2 |
| Molekylvikt (g/mol) | 284.353 |
| Frakt skick | Room Temperature |
| Kemiskt namn eller material | 4-(Benzyl(methyl)amino)-N-methoxy-N-methylbenzamide |
| dimIndustryType | Pharmaceutical |
| Lösningstyp | Neat |
O-Benzyl Ganciclovir N-Formamide Diacetate, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
| Molekylformel | C21 H23 N5 O7 |
|---|---|
| Analyt- eller komponentnamn | O-Benzyl Ganciclovir N-Formamide Diacetate |
| InChI formel | InChI=1S/C21H23N5O7/c1-14(28)30-9-17(10-31-15(2)29)33-13-26-11-22-18-19(26)24-21(23-12-27)25-20(18)32-8-16-6-4-3-5-7-16/h3-7,11-12,17H,8-10,13H2,1-2H3,(H,23,24,25,27) |
| Formel vikt | 457.16 |
| IUPAC-namn | [3-acetyloxy-2-[(2-formamido-6-phenylmethoxypurin-9-yl)methoxy]propyl] acetate |
| LEDER | CC(=O)OCC(COC(=O)C)OCn1cnc2c(OCc3ccccc3)nc(NC=O)nc12 |
| Molekylvikt (g/mol) | 457.437 |
| Frakt skick | Room Temperature |
| Kemiskt namn eller material | O-Benzyl Ganciclovir N-Formamide Diacetate |
| dimIndustryType | Pharmaceutical |
| Lösningstyp | Neat |
Isoleucine O-Benzyl N-Titryl Valsartan, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
| Molekylformel | C51 H51 N5 O3 |
|---|---|
| Analyt- eller komponentnamn | Isoleucine O-Benzyl N-Titryl Valsartan |
| InChI formel | InChI=1S/C51H51N5O3/c1-4-6-31-47(57)55(48(38(3)5-2)50(58)59-37-40-21-11-7-12-22-40)36-39-32-34-41(35-33-39)45-29-19-20-30-46(45)49-52-54-56(53-49)51(42-23-13-8-14-24-42,43-25-15-9-16-26-43)44-27-17-10-18-28-44/h7-30,32-35,38,48H,4-6,31,36-37H2,1-3H3/t38-,48-/m0/s1 |
| Formel vikt | 781.399 |
| IUPAC-namn | benzyl (2S,3S)-3-methyl-2-[pentanoyl-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]amino]pentanoate |
| LEDER | CCCCC(=O)N(Cc1ccc(cc1)c2ccccc2c3nnn(n3)C(c4ccccc4)(c5ccccc5)c6ccccc6)[C@@H]([C@@H](C)CC)C(=O)OCc7ccccc7 |
| Molekylvikt (g/mol) | 781.982 |
| Synonym | (2S,3S)-Benzyl 3-Methyl-2-(N-((2'-(2-trityl-2H-tetrazol-5-yl)-[1,1'-biphenyl]-4-yl)methyl)pentanamido)pentanoate |
| Frakt skick | Room Temperature |
| Kemiskt namn eller material | Isoleucine O-Benzyl N-Titryl Valsartan |
| dimIndustryType | Pharmaceutical |
| Lösningstyp | Neat |
O-Benzyl Ganciclovir N-Formyl Diacetate Dimer, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
| Molekylformel | C43 H46 N10 O14 |
|---|---|
| Analyt- eller komponentnamn | O-Benzyl Ganciclovir N-Formyl Diacetate Dimer |
| InChI formel | InChI=1S/C43H46N10O14/c1-28(56)60-17-34(18-61-29(2)57)66-26-50-21-44-36-38(50)46-42(48-40(36)64-15-32-11-7-5-8-12-32)52(24-54)23-53(25-55)43-47-39-37(41(49-43)65-16-33-13-9-6-10-14-33)45-22-51(39)27-67-35(19-62-30(3)58)20-63-31(4)59/h5-14,21-22,24-25,34-35H,15-20,23,26-27H2,1-4H3 |
| Formel vikt | 926.319 |
| IUPAC-namn | [3-acetyloxy-2-[[2-[[[9-(1,3-diacetyloxypropan-2-yloxymethyl)-6-phenylmethoxypurin-2-yl]-formylamino]methyl-formylamino]-6-phenylmethoxypurin-9-yl]methoxy]propyl] acetate |
| LEDER | CC(=O)OCC(COC(=O)C)OCn1cnc2c(OCc3ccccc3)nc(nc12)N(CN(C=O)c4nc(OCc5ccccc5)c6ncn(COC(COC(=O)C)COC(=O)C)c6n4)C=O |
| Molekylvikt (g/mol) | 926.884 |
| Frakt skick | Room Temperature |
| Kemiskt namn eller material | O-Benzyl Ganciclovir N-Formyl Diacetate Dimer |
| dimIndustryType | Pharmaceutical |
| Lösningstyp | Neat |
Isoleucine O-Benzyl N-Trityl Des-pentanal Valsartan, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
| Molekylformel | C46 H43 N5 O2 |
|---|---|
| Analyt- eller komponentnamn | Isoleucine O-Benzyl N-Trityl Des-pentanal Valsartan |
| InChI formel | InChI=1S/C46H43N5O2/c1-3-34(2)43(45(52)53-33-36-18-8-4-9-19-36)47-32-35-28-30-37(31-29-35)41-26-16-17-27-42(41)44-48-50-51(49-44)46(38-20-10-5-11-21-38,39-22-12-6-13-23-39)40-24-14-7-15-25-40/h4-31,34,43,47H,3,32-33H2,1-2H3/t34-,43-/m0/s1 |
| Formel vikt | 697.342 |
| IUPAC-namn | benzyl (2S,3S)-3-methyl-2-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methylamino]pentanoate |
| LEDER | CC[C@H](C)[C@H](NCc1ccc(cc1)c2ccccc2c3nnn(n3)C(c4ccccc4)(c5ccccc5)c6ccccc6)C(=O)OCc7ccccc7 |
| Molekylvikt (g/mol) | 697.866 |
| Synonym | (2S,3S)-Benzyl 3-Methyl-2-(((2'-(2-trityl-2H-tetrazol-5-yl)-[1,1'-biphenyl]-4-yl)methyl)amino)pentanoate |
| Frakt skick | Room Temperature |
| Kemiskt namn eller material | Isoleucine O-Benzyl N-Trityl Des-pentanal Valsartan |
| dimIndustryType | Pharmaceutical |
| Lösningstyp | Neat |
M-Benzyl-N-trifluoroacetyl-L-tryptophan Methyl Ester, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
| Molekylformel | C21 H19 F3 N2 O3 |
|---|---|
| Analyt- eller komponentnamn | M-Benzyl-N-trifluoroacetyl-L-tryptophan Methyl Ester |
| InChI formel | InChI=1S/C21H19F3N2O3/c1-29-19(27)18(11-15-12-25-17-10-6-5-9-16(15)17)26(20(28)21(22,23)24)13-14-7-3-2-4-8-14/h2-10,12,18,25H,11,13H2,1H3/t18-/m0/s1 |
| Formel vikt | 404.135 |
| IUPAC-namn | methyl (2S)-2-[benzyl-(2,2,2-trifluoroacetyl)amino]-3-(1H-indol-3-yl)propanoate |
| LEDER | COC(=O)[C@H](Cc1c[nH]c2ccccc12)N(Cc3ccccc3)C(=O)C(F)(F)F |
| Molekylvikt (g/mol) | 404.382 |
| Frakt skick | Room Temperature |
| Kemiskt namn eller material | M-Benzyl-N-trifluoroacetyl-L-tryptophan Methyl Ester |
| dimIndustryType | Pharmaceutical |
| Lösningstyp | Neat |
N-(9-Benzyl-6-chloro-9H-purin-2-yl)formamide, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
| Molekylformel | C13 H12 Cl N5 O |
|---|---|
| Analyt- eller komponentnamn | N-(9-Benzyl-6-chloro-9H-purin-2-yl)formamide |
| InChI formel | InChI=1S/C13H12ClN5O/c14-11-10-12(18-13(17-11)16-8-20)19(7-15-10)6-9-4-2-1-3-5-9/h1-5,7-8,11H,6H2,(H2,16,17,18,20) |
| Formel vikt | 289.073 |
| IUPAC-namn | N-(9-benzyl-6-chloro-1,6-dihydropurin-2-yl)formamide |
| LEDER | ClC1NC(=Nc2c1ncn2Cc3ccccc3)NC=O |
| Molekylvikt (g/mol) | 289.72 |
| Frakt skick | Room Temperature |
| Kemiskt namn eller material | N-(9-Benzyl-6-chloro-9H-purin-2-yl)formamide |
| dimIndustryType | Pharmaceutical |
| Lösningstyp | Neat |
N-Benzyloxycarbonyl-4-O-benzyl Dopamine 3-Beta-D-Glucuronide Sodium Salt, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
| Molekylformel | C29H30NNaO10 |
|---|---|
| Rekommenderad förvaring | -20°C |
| Analyt- eller komponentnamn | N-Benzyloxycarbonyl-4-O-benzyl Dopamine 3-beta-D-Glucuronide Sodium Salt |
| InChI formel | InChI=1S/C29H31NO10.Na/c31-23-24(32)26(27(34)35)40-28(25(23)33)39-22-15-18(11-12-21(22)37-16-19-7-3-1-4-8-19)13-14-30-29(36)38-17-20-9-5-2-6-10-20;/h1-12,15,23-26,28,31-33H,13-14,16-17H2,(H,30,36)(H,34,35);/q;+1/p-1/t23-,24-,25+,26?,28+;/m0./s1 |
| Formel vikt | 575.18 |
| IUPAC-namn | sodium (2S,3S,4S,5R,6S)-6-(2-(benzyloxy)-5-(2-(((benzyloxy)carbonyl)amino)ethyl)phenoxy)-3,4,5-trihydroxytetrahydro-2H-pyran-2-carboxylate |
| LEDER | O[C@H]1[C@H](O)[C@@H](O)[C@H](OC2=C(OCC3=CC=CC=C3)C=CC(CCNC(OCC4=CC=CC=C4)=O)=C2)O[C@@H]1C(O[Na])=O |
| Molekylvikt (g/mol) | 575.54 |
| Synonym | 5-(2-(N-Benzyloxycarbonyl)aminoethyl)-2-(O-benzyl)hydroxyphenyl β-D-Glucopyranosiduronic Acid Sodium Salt |
| Frakt skick | Room Temperature |
| Kemiskt namn eller material | N-Benzyloxycarbonyl-4-O-benzyl Dopamine 3-beta-D-Glucuronide Sodium Salt |
| dimIndustryType | Pharmaceutical |
| Lösningstyp | Neat |
2-(1-Benzyl-1H-indol-5-yl)-2-(1H-indol-5-yl)-N-methylethane-1-sulfonamide, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
| Molekylformel | C26 H25 N3 O2 S |
|---|---|
| Analyt- eller komponentnamn | 2-(1-Benzyl-1H-indol-5-yl)-2-(1H-indol-5-yl)-N-methylethane-1-sulfonamide |
| InChI formel | InChI=1S/C26H25N3O2S/c1-27-32(30,31)18-24(20-7-9-25-22(15-20)11-13-28-25)21-8-10-26-23(16-21)12-14-29(26)17-19-5-3-2-4-6-19/h2-16,24,27-28H,17-18H2,1H3 |
| Formel vikt | 443.167 |
| IUPAC-namn | 2-(1-benzylindol-5-yl)-2-(1H-indol-5-yl)-N-methylethanesulfonamide |
| LEDER | CNS(=O)(=O)CC(c1ccc2[nH]ccc2c1)c3ccc4c(ccn4Cc5ccccc5)c3 |
| Molekylvikt (g/mol) | 443.561 |
| Frakt skick | Room Temperature |
| Kemiskt namn eller material | 2-(1-Benzyl-1H-indol-5-yl)-2-(1H-indol-5-yl)-N-methylethane-1-sulfonamide |
| dimIndustryType | Pharmaceutical |
| Lösningstyp | Neat |
N-Benzyloxycarbonyl-4-O-benzyl Dopamine Tri-O-acetyl-3-Beta-D-Glucuronic Acid Methyl Ester, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
| Molekylformel | C36H39NO13 |
|---|---|
| Rekommenderad förvaring | +4°C |
| Analyt- eller komponentnamn | N-Benzyloxycarbonyl-4-O-benzyl Dopamine Tri-O-acetyl-3-beta-D-Glucuronic Acid Methyl Ester |
| InChI formel | InChI=1S/C36H39NO13/c1-22(38)46-30-31(47-23(2)39)33(48-24(3)40)35(50-32(30)34(41)43-4)49-29-19-25(15-16-28(29)44-20-26-11-7-5-8-12-26)17-18-37-36(42)45-21-27-13-9-6-10-14-27/h5-16,19,30-33,35H,17-18,20-21H2,1-4H3,(H,37,42)/t30?,31?,32-,33?,35+/m0/s1 |
| Formel vikt | 639.24 |
| IUPAC-namn | N-Benzyloxycarbonyl-4-O-benzyl Dopamine Tri-O-acetyl-3-b-D-Glucuronic Acid Methyl Ester |
| LEDER | O=C(OCC1=CC=CC=C1)NCCC2=CC(O[C@H]3[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](C(OC)=O)O3)=C(OCC4=CC=CC=C4)C=C2 |
| Molekylvikt (g/mol) | 693.69 |
| Synonym | 5-(2-(N-Benzyloxycarbonyl)aminoethyl)-2-(O-benzyl)hydroxyphenyl Tri-O-acetyl-β-D-glucopyranosiduronic Acid Methyl Ester |
| Frakt skick | Room Temperature |
| Kemiskt namn eller material | N-Benzyloxycarbonyl-4-O-benzyl Dopamine Tri-O-acetyl-3-beta-D-Glucuronic Acid Methyl Ester |
| dimIndustryType | Pharmaceutical |
| Lösningstyp | Neat |